Organic acids and derivatives
Filtered Search Results
Ethylene glycol-O,O'-bis(2-aminoethyl)-N,N,N',N'-tetraacetic acid, 0.5M aq. soln., pH 8.0
CAS: 67-42-5 Molecular Formula: C14H24N2O10 Molecular Weight (g/mol): 380.35 MDL Number: MFCD00004291 InChI Key: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC Name: 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
| PubChem CID | 6207 |
|---|---|
| CAS | 67-42-5 |
| Molecular Weight (g/mol) | 380.35 |
| ChEBI | CHEBI:30740 |
| MDL Number | MFCD00004291 |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Molecular Formula | C14H24N2O10 |
Ethylenediaminetetraacetic acid, 99%
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |
Ethylenediaminetetraacetic acid, ACS, 99.4+%
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |
1,2,4,5-Benzenetetracarboxylic acid, 96%
CAS: 89-05-4 Molecular Formula: C10H6O8 Molecular Weight (g/mol): 254.15 MDL Number: MFCD00002471 InChI Key: CYIDZMCFTVVTJO-UHFFFAOYSA-N Synonym: pyromellitic acid,1,2,4,5-benzenetetracarboxylic acid,usaf xr-20,1,2,4,5-tetracarboxybenzene,unii-d9uxg2u6zu,1,2,4,5-benzene-tetracarboxylic acid,d9uxg2u6zu,pubchem21809,acmc-20ap78,1,4,5-tetracarboxybenzene PubChem CID: 6961 ChEBI: CHEBI:45165 IUPAC Name: benzene-1,2,4,5-tetracarboxylic acid SMILES: C1=C(C(=CC(=C1C(=O)O)C(=O)O)C(=O)O)C(=O)O
| PubChem CID | 6961 |
|---|---|
| CAS | 89-05-4 |
| Molecular Weight (g/mol) | 254.15 |
| ChEBI | CHEBI:45165 |
| MDL Number | MFCD00002471 |
| SMILES | C1=C(C(=CC(=C1C(=O)O)C(=O)O)C(=O)O)C(=O)O |
| Synonym | pyromellitic acid,1,2,4,5-benzenetetracarboxylic acid,usaf xr-20,1,2,4,5-tetracarboxybenzene,unii-d9uxg2u6zu,1,2,4,5-benzene-tetracarboxylic acid,d9uxg2u6zu,pubchem21809,acmc-20ap78,1,4,5-tetracarboxybenzene |
| IUPAC Name | benzene-1,2,4,5-tetracarboxylic acid |
| InChI Key | CYIDZMCFTVVTJO-UHFFFAOYSA-N |
| Molecular Formula | C10H6O8 |
Biphenyl-3,3',5,5'-tetracarboxylic acid, Thermo Scientific Chemicals
CAS: 4371-28-2 Molecular Formula: C16H10O8 Molecular Weight (g/mol): 330.25 MDL Number: MFCD16621475 InChI Key: QURGMSIQFRADOZ-UHFFFAOYSA-N IUPAC Name: [1,1'-biphenyl]-3,3',5,5'-tetracarboxylic acid SMILES: OC(=O)C1=CC(=CC(=C1)C(O)=O)C1=CC(=CC(=C1)C(O)=O)C(O)=O
| CAS | 4371-28-2 |
|---|---|
| Molecular Weight (g/mol) | 330.25 |
| MDL Number | MFCD16621475 |
| SMILES | OC(=O)C1=CC(=CC(=C1)C(O)=O)C1=CC(=CC(=C1)C(O)=O)C(O)=O |
| IUPAC Name | [1,1'-biphenyl]-3,3',5,5'-tetracarboxylic acid |
| InChI Key | QURGMSIQFRADOZ-UHFFFAOYSA-N |
| Molecular Formula | C16H10O8 |
Thermo Scientific Chemicals o-Cresolphthalein complexone, indicator grade
CAS: 2411-89-4 Molecular Formula: C32H32N2O12 Molecular Weight (g/mol): 636.61 MDL Number: MFCD00005911 InChI Key: IYZPEGVSBUNMBE-UHFFFAOYSA-N Synonym: o-cresolphthalein complexone,phthalein purple,cresolphthalexon,o-cresolphthalexon,phthalein complexon,o-cresolphthalein complexon,cresolphthalein complexon,metal phthalein,cresolphthalein complexone,unii-a4p6737i7f PubChem CID: 75485 IUPAC Name: 2-[[5-[1-[3-[[bis(carboxymethyl)amino]methyl]-4-hydroxy-5-methylphenyl]-3-oxo-2-benzofuran-1-yl]-2-hydroxy-3-methylphenyl]methyl-(carboxymethyl)amino]acetic acid SMILES: CC1=CC(=CC(CN(CC(O)=O)CC(O)=O)=C1O)C1(OC(=O)C2=CC=CC=C12)C1=CC(C)=C(O)C(CN(CC(O)=O)CC(O)=O)=C1
| PubChem CID | 75485 |
|---|---|
| CAS | 2411-89-4 |
| Molecular Weight (g/mol) | 636.61 |
| MDL Number | MFCD00005911 |
| SMILES | CC1=CC(=CC(CN(CC(O)=O)CC(O)=O)=C1O)C1(OC(=O)C2=CC=CC=C12)C1=CC(C)=C(O)C(CN(CC(O)=O)CC(O)=O)=C1 |
| Synonym | o-cresolphthalein complexone,phthalein purple,cresolphthalexon,o-cresolphthalexon,phthalein complexon,o-cresolphthalein complexon,cresolphthalein complexon,metal phthalein,cresolphthalein complexone,unii-a4p6737i7f |
| IUPAC Name | 2-[[5-[1-[3-[[bis(carboxymethyl)amino]methyl]-4-hydroxy-5-methylphenyl]-3-oxo-2-benzofuran-1-yl]-2-hydroxy-3-methylphenyl]methyl-(carboxymethyl)amino]acetic acid |
| InChI Key | IYZPEGVSBUNMBE-UHFFFAOYSA-N |
| Molecular Formula | C32H32N2O12 |
5,6-Dihydrouracil, 97%
CAS: 504-07-4 Molecular Formula: C4H6N2O2 Molecular Weight (g/mol): 114.10 MDL Number: MFCD00006029 InChI Key: OIVLITBTBDPEFK-UHFFFAOYSA-N Synonym: dihydrouracil,5,6-dihydrouracil,hydrouracil,5,6-dihydro-2,4-dihydroxypyrimidine,dihydropyrimidine-2,4 1h,3h-dione,dihydrouracile,2,4 1h,3h-pyrimidinedione, dihydro,di-h-uracil,dihydro-2,4 1h,3h-pyrimidinedione,hydrouracil 8ci PubChem CID: 649 ChEBI: CHEBI:15901 IUPAC Name: 1,3-diazinane-2,4-dione SMILES: O=C1CCNC(=O)N1
| PubChem CID | 649 |
|---|---|
| CAS | 504-07-4 |
| Molecular Weight (g/mol) | 114.10 |
| ChEBI | CHEBI:15901 |
| MDL Number | MFCD00006029 |
| SMILES | O=C1CCNC(=O)N1 |
| Synonym | dihydrouracil,5,6-dihydrouracil,hydrouracil,5,6-dihydro-2,4-dihydroxypyrimidine,dihydropyrimidine-2,4 1h,3h-dione,dihydrouracile,2,4 1h,3h-pyrimidinedione, dihydro,di-h-uracil,dihydro-2,4 1h,3h-pyrimidinedione,hydrouracil 8ci |
| IUPAC Name | 1,3-diazinane-2,4-dione |
| InChI Key | OIVLITBTBDPEFK-UHFFFAOYSA-N |
| Molecular Formula | C4H6N2O2 |
Thermo Scientific Chemicals Adenosine-5'-monophosphoric acid, 99% (dry wt.), water <6%
CAS: 61-19-8 Molecular Formula: C10H14N5O7P Molecular Weight (g/mol): 347.22 MDL Number: MFCD00005750 InChI Key: UDMBCSSLTHHNCD-YPLCUDRINA-N Synonym: adenosine 5'-monophosphate,5'-adenylic acid,adenosine monophosphate,adenosine phosphate,adenylic acid,adenylate,phosphaden,5'-amp,adenosine 5'-phosphate,phosphentaside PubChem CID: 6083 ChEBI: CHEBI:16027 IUPAC Name: [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate SMILES: NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1
| PubChem CID | 6083 |
|---|---|
| CAS | 61-19-8 |
| Molecular Weight (g/mol) | 347.22 |
| ChEBI | CHEBI:16027 |
| MDL Number | MFCD00005750 |
| SMILES | NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1 |
| Synonym | adenosine 5'-monophosphate,5'-adenylic acid,adenosine monophosphate,adenosine phosphate,adenylic acid,adenylate,phosphaden,5'-amp,adenosine 5'-phosphate,phosphentaside |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| InChI Key | UDMBCSSLTHHNCD-YPLCUDRINA-N |
| Molecular Formula | C10H14N5O7P |
L(+)-Potassium hydrogen tartrate, 99%
CAS: 868-14-4 Molecular Formula: C4H5KO6 Molecular Weight (g/mol): 188.18 MDL Number: MFCD00065392,MFCD00071626,MFCD00064206 InChI Key: KYKNRZGSIGMXFH-ZVGUSBNCSA-M Synonym: potassium bitartrate,l +-potassium hydrogen tartrate,potassium 3-carboxy-2,3-dihydroxypropanoate,monopotassium tartrate,potassium acid tartrate,kaliumtartrat,potassium hydrogentartrate,1-potassium hydrogentartrate,ksc657e1t,butanedioic acid, 2,3-dihydroxy-2r,3r-, potassium salt 1:1 PubChem CID: 24193652 IUPAC Name: 2,3-dihydroxybutanedioic acid;potassium SMILES: [K+].O[C@H]([C@@H](O)C([O-])=O)C(O)=O
| PubChem CID | 24193652 |
|---|---|
| CAS | 868-14-4 |
| Molecular Weight (g/mol) | 188.18 |
| MDL Number | MFCD00065392,MFCD00071626,MFCD00064206 |
| SMILES | [K+].O[C@H]([C@@H](O)C([O-])=O)C(O)=O |
| Synonym | potassium bitartrate,l +-potassium hydrogen tartrate,potassium 3-carboxy-2,3-dihydroxypropanoate,monopotassium tartrate,potassium acid tartrate,kaliumtartrat,potassium hydrogentartrate,1-potassium hydrogentartrate,ksc657e1t,butanedioic acid, 2,3-dihydroxy-2r,3r-, potassium salt 1:1 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;potassium |
| InChI Key | KYKNRZGSIGMXFH-ZVGUSBNCSA-M |
| Molecular Formula | C4H5KO6 |
Ethylene glycol-O,O'-bis(2-aminoethyl)-N,N,N',N'-tetraacetic acid, 97%
CAS: 67-42-5 Molecular Formula: C14H24N2O10 Molecular Weight (g/mol): 380.35 MDL Number: MFCD00004291 InChI Key: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC Name: 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
| PubChem CID | 6207 |
|---|---|
| CAS | 67-42-5 |
| Molecular Weight (g/mol) | 380.35 |
| ChEBI | CHEBI:30740 |
| MDL Number | MFCD00004291 |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Molecular Formula | C14H24N2O10 |
trans-1,2-Diaminocyclohexane-N,N,N',N'-tetraacetic acid monohydrate, 98%
CAS: 125572-95-4 Molecular Formula: C14H20N2O8 Molecular Weight (g/mol): 344.32 MDL Number: MFCD00149243,MFCD00066429,MFCD00003845 InChI Key: FCKYPQBAHLOOJQ-NXEZZACHSA-L Synonym: 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd PubChem CID: 2723844 IUPAC Name: 2-[[(1R,2R)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid;hydrate SMILES: [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O
| PubChem CID | 2723844 |
|---|---|
| CAS | 125572-95-4 |
| Molecular Weight (g/mol) | 344.32 |
| MDL Number | MFCD00149243,MFCD00066429,MFCD00003845 |
| SMILES | [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O |
| Synonym | 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd |
| IUPAC Name | 2-[[(1R,2R)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid;hydrate |
| InChI Key | FCKYPQBAHLOOJQ-NXEZZACHSA-L |
| Molecular Formula | C14H20N2O8 |
trans-1,2-Diaminocyclohexane-N,N,N',N'-tetraacetic acid monohydrate, ACS, 97.5%-100.5%
CAS: 125572-95-4 Molecular Formula: C14H20N2O8 Molecular Weight (g/mol): 344.32 MDL Number: MFCD00149243,MFCD00066429,MFCD00003845 InChI Key: FCKYPQBAHLOOJQ-NXEZZACHSA-L Synonym: 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd PubChem CID: 2723844 IUPAC Name: 2-[[(1R,2R)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid;hydrate SMILES: [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O
| PubChem CID | 2723844 |
|---|---|
| CAS | 125572-95-4 |
| Molecular Weight (g/mol) | 344.32 |
| MDL Number | MFCD00149243,MFCD00066429,MFCD00003845 |
| SMILES | [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O |
| Synonym | 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd |
| IUPAC Name | 2-[[(1R,2R)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid;hydrate |
| InChI Key | FCKYPQBAHLOOJQ-NXEZZACHSA-L |
| Molecular Formula | C14H20N2O8 |
BAPTA, MedChemExpress
MedChemExpress BAPTA is a non-permeable, selective extracellular calcium chelator, with 105-fold greater affinity for Ca2+ than Mg2+. BAPTA is a valuable tool to study the role of calcium in cell signaling.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Molecular Weight (g/mol) | 476.43 |
|---|---|
| Color | Off-White |
| Physical Form | Solid |
| Chemical Name or Material | BAPTA |
| Grade | Research |
| SMILES | O=C(O)CN(C1=CC=CC=C1OCCOC2=CC=CC=C2N(CC(O)=O)CC(O)=O)CC(O)=O |
| Percent Purity | 97.0% |
| CAS | 85233-19-8 |
| Solubility Information | 1M NaOH : 100 mg/mL (209.89 mM; ultrasonic and adjust pH to 11 with NaOH) ∣DMSO : 15.62 mg/mL (32.79 mM; ultrasonic and warming and heat to 60°C) |
| Health Hazard 1 | H315∣H319∣H335 |
| Purity Grade Notes | Research |
| Recommended Storage | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Shelf Life | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Molecular Formula | C22H24N2O10 |
| Formula Weight | 476.43 |
Enoxacin hydrate, MedChemExpress
MedChemExpress Enoxacin hydrate (Enoxacin sesquihydrate), a fluoroquinolone, interferes with DNA replication and inhibits bacterial DNA gyrase (IC50=126 μg/ml) and topoisomerase IV (IC50=26.5 μg/ml).
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Molecular Weight (g/mol) | 347.34 |
|---|---|
| Color | Off-White |
| Physical Form | Solid |
| Chemical Name or Material | Enoxacin hydrate |
| Grade | Research |
| SMILES | O=C(C1=CN(CC)C2=C(C=C(F)C(N3CCNCC3)=N2)C1=O)O.[1.5H2O] |
| For Use With (Application) | COVID-19-immunoregulation |
| Percent Purity | 98.15% |
| CAS | 84294-96-2 |
| Solubility Information | 1M NaOH : 100 mg/mL (287.90 mM; ultrasonic and adjust pH to 11 with NaOH) ∣DMSO : 2.78 mg/mL (8.00 mM; Need ultrasonic) ∣H2O : 1 mg/mL (2.88 mM; ultrasonic and warming and heat to 80°C) |
| Synonym | Enoxacin sesquihydrateAT-2266 hydrateCI-919 hydrate |
| Purity Grade Notes | Research |
| Recommended Storage | 4°C, protect from light∣In solvent : -80°C, 6 months∣-20°C, 1 month (protect from light) |
| Shelf Life | 4°C, protect from light∣In solvent : -80°C, 6 months∣-20°C, 1 month (protect from light) |
| Molecular Formula | C15H17FN4O3.3/2H2O |
| Formula Weight | 347.34 |